C19H31NO3 — CID 82073664
1-(3,4-diethoxyphenyl)-3-(4-methylpiperidin-1-yl)propan-1-ol (PubChem CID 82073664) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)-3-(4-methylpiperidin-1-yl)propan-1-ol.
| Compound Name | 1-(3,4-diethoxyphenyl)-3-(4-methylpiperidin-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 82073664 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)-3-(4-methylpiperidin-1-yl)propan-1-ol |
| SMILES | CCOc1ccc(C(O)CCN2CCC(C)CC2)cc1OCC |
| InChI | InChI=1S/C19H31NO3/c1-4-22-18-7-6-16(14-19(18)23-5-2)17(21)10-13-20-11-8-15(3)9-12-20/h6-7,14-15,17,21H,4-5,8-13H2,1-3H3 |
| InChIKey | ZBFDLGFFCJWKPK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |