6-(3,4-diethoxyphenyl)-6-hydroxyhexanoic acid

C16H24O5 — CID 43447097

IUPAC6-(3,4-diethoxyphenyl)-6-hydroxyhexanoic acid
SMILESCCOc1ccc(C(O)CCCCC(=O)O)cc1OCC
InChIInChI=1S/C16H24O5/c1-3-20-14-10-9-12(11-15(14)21-4-2)13(17)7-5-6-8-16(18)19/h9-11,13,17H,3-8H2,1-2H3,(H,18,19)
InChIKeyWKWSFOZKBRTTJS-UHFFFAOYSA-N
MW296.36 g/mol
LogP3.16
Rot. Bonds10

About 6-(3,4-diethoxyphenyl)-6-hydroxyhexanoic acid

6-(3,4-diethoxyphenyl)-6-hydroxyhexanoic acid (PubChem CID 43447097) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is 6-(3,4-diethoxyphenyl)-6-hydroxyhexanoic acid.

Molecular Properties

Compound Name6-(3,4-diethoxyphenyl)-6-hydroxyhexanoic acid
PubChem CID43447097
Molecular FormulaC16H24O5
Molecular Weight296.36 g/mol
Exact Mass296.16
IUPAC Name6-(3,4-diethoxyphenyl)-6-hydroxyhexanoic acid
SMILESCCOc1ccc(C(O)CCCCC(=O)O)cc1OCC
InChIInChI=1S/C16H24O5/c1-3-20-14-10-9-12(11-15(14)21-4-2)13(17)7-5-6-8-16(18)19/h9-11,13,17H,3-8H2,1-2H3,(H,18,19)
InChIKeyWKWSFOZKBRTTJS-UHFFFAOYSA-N
XLogP3.16
TPSA75.99 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.36
LogP ≤ 53.16
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 6-(3,4-diethoxyphenyl)-6-hydroxyhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(3,4-diethoxyphenyl)-6-hydroxyhexanoic acid?
The IUPAC name of 6-(3,4-diethoxyphenyl)-6-hydroxyhexanoic acid (CID 43447097) is 6-(3,4-diethoxyphenyl)-6-hydroxyhexanoic acid.
What is the SMILES notation for 6-(3,4-diethoxyphenyl)-6-hydroxyhexanoic acid?
The canonical SMILES for 6-(3,4-diethoxyphenyl)-6-hydroxyhexanoic acid is CCOc1ccc(C(O)CCCCC(=O)O)cc1OCC.
What is the InChIKey of 6-(3,4-diethoxyphenyl)-6-hydroxyhexanoic acid?
The InChIKey is WKWSFOZKBRTTJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O5/c1-3-20-14-10-9-12(11-15(14)21-4-2)13(17)7-5-6-8-16(18)19/h9-11,13,17H,3-8H2,1-2H3,(H,18,19).
What are the key properties of 6-(3,4-diethoxyphenyl)-6-hydroxyhexanoic acid?
6-(3,4-diethoxyphenyl)-6-hydroxyhexanoic acid has a molecular weight of 296.36 g/mol, XLogP of 3.16, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-diethoxyphenyl)-6-hydroxyhexanoic acid is sourced from PubChem (CID 43447097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).