2-[[2-(3,4-diethoxyphenyl)-2-hydroxyethyl]amino]acetic acid

C14H21NO5 — CID 82315710

IUPAC2-[[2-(3,4-diethoxyphenyl)-2-hydroxyethyl]amino]acetic acid
SMILESCCOc1ccc(C(O)CNCC(=O)O)cc1OCC
InChIInChI=1S/C14H21NO5/c1-3-19-12-6-5-10(7-13(12)20-4-2)11(16)8-15-9-14(17)18/h5-7,11,15-16H,3-4,8-9H2,1-2H3,(H,17,18)
InChIKeySSCHWLZRKNLBDW-UHFFFAOYSA-N
MW283.32 g/mol
LogP1.19
Rot. Bonds9

About 2-[[2-(3,4-diethoxyphenyl)-2-hydroxyethyl]amino]acetic acid

2-[[2-(3,4-diethoxyphenyl)-2-hydroxyethyl]amino]acetic acid (PubChem CID 82315710) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-[[2-(3,4-diethoxyphenyl)-2-hydroxyethyl]amino]acetic acid.

Molecular Properties

Compound Name2-[[2-(3,4-diethoxyphenyl)-2-hydroxyethyl]amino]acetic acid
PubChem CID82315710
Molecular FormulaC14H21NO5
Molecular Weight283.32 g/mol
Exact Mass283.14
IUPAC Name2-[[2-(3,4-diethoxyphenyl)-2-hydroxyethyl]amino]acetic acid
SMILESCCOc1ccc(C(O)CNCC(=O)O)cc1OCC
InChIInChI=1S/C14H21NO5/c1-3-19-12-6-5-10(7-13(12)20-4-2)11(16)8-15-9-14(17)18/h5-7,11,15-16H,3-4,8-9H2,1-2H3,(H,17,18)
InChIKeySSCHWLZRKNLBDW-UHFFFAOYSA-N
XLogP1.19
TPSA88.02 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds9
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.32
LogP ≤ 51.19
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-[[2-(3,4-diethoxyphenyl)-2-hydroxyethyl]amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[2-(3,4-diethoxyphenyl)-2-hydroxyethyl]amino]acetic acid?
The IUPAC name of 2-[[2-(3,4-diethoxyphenyl)-2-hydroxyethyl]amino]acetic acid (CID 82315710) is 2-[[2-(3,4-diethoxyphenyl)-2-hydroxyethyl]amino]acetic acid.
What is the SMILES notation for 2-[[2-(3,4-diethoxyphenyl)-2-hydroxyethyl]amino]acetic acid?
The canonical SMILES for 2-[[2-(3,4-diethoxyphenyl)-2-hydroxyethyl]amino]acetic acid is CCOc1ccc(C(O)CNCC(=O)O)cc1OCC.
What is the InChIKey of 2-[[2-(3,4-diethoxyphenyl)-2-hydroxyethyl]amino]acetic acid?
The InChIKey is SSCHWLZRKNLBDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO5/c1-3-19-12-6-5-10(7-13(12)20-4-2)11(16)8-15-9-14(17)18/h5-7,11,15-16H,3-4,8-9H2,1-2H3,(H,17,18).
What are the key properties of 2-[[2-(3,4-diethoxyphenyl)-2-hydroxyethyl]amino]acetic acid?
2-[[2-(3,4-diethoxyphenyl)-2-hydroxyethyl]amino]acetic acid has a molecular weight of 283.32 g/mol, XLogP of 1.19, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(3,4-diethoxyphenyl)-2-hydroxyethyl]amino]acetic acid is sourced from PubChem (CID 82315710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).