methyl 2-(3,4-diethoxyphenyl)propanoate

C14H20O4 — CID 55071930

IUPACmethyl 2-(3,4-diethoxyphenyl)propanoate
SMILESCCOc1ccc(C(C)C(=O)OC)cc1OCC
InChIInChI=1S/C14H20O4/c1-5-17-12-8-7-11(9-13(12)18-6-2)10(3)14(15)16-4/h7-10H,5-6H2,1-4H3
InChIKeyXZTHBQMOYWPSPK-UHFFFAOYSA-N
MW252.31 g/mol
LogP2.76
Rot. Bonds6

About methyl 2-(3,4-diethoxyphenyl)propanoate

methyl 2-(3,4-diethoxyphenyl)propanoate (PubChem CID 55071930) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is methyl 2-(3,4-diethoxyphenyl)propanoate.

Molecular Properties

Compound Namemethyl 2-(3,4-diethoxyphenyl)propanoate
PubChem CID55071930
Molecular FormulaC14H20O4
Molecular Weight252.31 g/mol
Exact Mass252.14
IUPAC Namemethyl 2-(3,4-diethoxyphenyl)propanoate
SMILESCCOc1ccc(C(C)C(=O)OC)cc1OCC
InChIInChI=1S/C14H20O4/c1-5-17-12-8-7-11(9-13(12)18-6-2)10(3)14(15)16-4/h7-10H,5-6H2,1-4H3
InChIKeyXZTHBQMOYWPSPK-UHFFFAOYSA-N
XLogP2.76
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.31
LogP ≤ 52.76
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-(3,4-diethoxyphenyl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3,4-diethoxyphenyl)propanoate?
The IUPAC name of methyl 2-(3,4-diethoxyphenyl)propanoate (CID 55071930) is methyl 2-(3,4-diethoxyphenyl)propanoate.
What is the SMILES notation for methyl 2-(3,4-diethoxyphenyl)propanoate?
The canonical SMILES for methyl 2-(3,4-diethoxyphenyl)propanoate is CCOc1ccc(C(C)C(=O)OC)cc1OCC.
What is the InChIKey of methyl 2-(3,4-diethoxyphenyl)propanoate?
The InChIKey is XZTHBQMOYWPSPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O4/c1-5-17-12-8-7-11(9-13(12)18-6-2)10(3)14(15)16-4/h7-10H,5-6H2,1-4H3.
What are the key properties of methyl 2-(3,4-diethoxyphenyl)propanoate?
methyl 2-(3,4-diethoxyphenyl)propanoate has a molecular weight of 252.31 g/mol, XLogP of 2.76, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,4-diethoxyphenyl)propanoate is sourced from PubChem (CID 55071930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).