C18H28O3 — CID 79304001
2-(3,4-dipropoxyphenyl)-4-methylpentan-3-one (PubChem CID 79304001) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 2-(3,4-dipropoxyphenyl)-4-methylpentan-3-one.
| Compound Name | 2-(3,4-dipropoxyphenyl)-4-methylpentan-3-one |
|---|---|
| PubChem CID | 79304001 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2-(3,4-dipropoxyphenyl)-4-methylpentan-3-one |
| SMILES | CCCOc1ccc(C(C)C(=O)C(C)C)cc1OCCC |
| InChI | InChI=1S/C18H28O3/c1-6-10-20-16-9-8-15(12-17(16)21-11-7-2)14(5)18(19)13(3)4/h8-9,12-14H,6-7,10-11H2,1-5H3 |
| InChIKey | OXIGKKJGPUZJJK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |