C17H29NO3 — CID 114987094
(2R)-2-[1-(3,4-dipropoxyphenyl)ethylamino]propan-1-ol (PubChem CID 114987094) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is (2R)-2-[1-(3,4-dipropoxyphenyl)ethylamino]propan-1-ol.
| Compound Name | (2R)-2-[1-(3,4-dipropoxyphenyl)ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 114987094 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | (2R)-2-[1-(3,4-dipropoxyphenyl)ethylamino]propan-1-ol |
| SMILES | CCCOc1ccc(C(C)N[C@H](C)CO)cc1OCCC |
| InChI | InChI=1S/C17H29NO3/c1-5-9-20-16-8-7-15(11-17(16)21-10-6-2)14(4)18-13(3)12-19/h7-8,11,13-14,18-19H,5-6,9-10,12H2,1-4H3/t13-,14?/m1/s1 |
| InChIKey | VRWRMDOOOBPKJR-KWCCSABGSA-N |
| XLogP | 3.30 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |