C13H17NO7 — CID 70059281
2-[2-(carboxymethoxy)-4-[1-hydroxy-2-(methylamino)ethyl]phenoxy]acetic acid (PubChem CID 70059281) has the molecular formula C13H17NO7 and a molecular weight of 299.28 g/mol. Its IUPAC name is 2-[2-(carboxymethoxy)-4-[1-hydroxy-2-(methylamino)ethyl]phenoxy]acetic acid.
| Compound Name | 2-[2-(carboxymethoxy)-4-[1-hydroxy-2-(methylamino)ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 70059281 |
| Molecular Formula | C13H17NO7 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 2-[2-(carboxymethoxy)-4-[1-hydroxy-2-(methylamino)ethyl]phenoxy]acetic acid |
| SMILES | CNCC(O)c1ccc(OCC(=O)O)c(OCC(=O)O)c1 |
| InChI | InChI=1S/C13H17NO7/c1-14-5-9(15)8-2-3-10(20-6-12(16)17)11(4-8)21-7-13(18)19/h2-4,9,14-15H,5-7H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | MNVCSCOJLNXQRS-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |