C17H18Cl3NO6 — CID 70127273
4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;2-(2,4,5-trichlorophenoxy)acetic acid (PubChem CID 70127273) has the molecular formula C17H18Cl3NO6 and a molecular weight of 438.69 g/mol. Its IUPAC name is 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;2-(2,4,5-trichlorophenoxy)acetic acid.
| Compound Name | 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;2-(2,4,5-trichlorophenoxy)acetic acid |
|---|---|
| PubChem CID | 70127273 |
| Molecular Formula | C17H18Cl3NO6 |
| Molecular Weight | 438.69 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;2-(2,4,5-trichlorophenoxy)acetic acid |
| SMILES | CNC[C@H](O)c1ccc(O)c(O)c1.O=C(O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H13NO3.C8H5Cl3O3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6;9-4-1-6(11)7(2-5(4)10)14-3-8(12)13/h2-4,9-13H,5H2,1H3;1-2H,3H2,(H,12,13)/t9-;/m0./s1 |
| InChIKey | FUFDUBMMJWDQML-FVGYRXGTSA-N |
| XLogP | 3.46 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.69 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|