C9H16BNO6 — CID 23618421
boric acid;4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol (PubChem CID 23618421) has the molecular formula C9H16BNO6 and a molecular weight of 245.04 g/mol. Its IUPAC name is boric acid;4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol.
| Compound Name | boric acid;4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 23618421 |
| Molecular Formula | C9H16BNO6 |
| Molecular Weight | 245.04 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | boric acid;4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol |
| SMILES | CNC[C@H](O)c1ccc(O)c(O)c1.OB(O)O |
| InChI | InChI=1S/C9H13NO3.BH3O3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6;2-1(3)4/h2-4,9-13H,5H2,1H3;2-4H/t9-;/m0./s1 |
| InChIKey | HSBXYUAEUBTSSQ-FVGYRXGTSA-N |
| XLogP | -1.70 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.04 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|