C9H13ClNNaO3 — CID 174756001
sodium;4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;chloride (PubChem CID 174756001) has the molecular formula C9H13ClNNaO3 and a molecular weight of 241.65 g/mol. Its IUPAC name is sodium;4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;chloride.
| Compound Name | sodium;4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;chloride |
|---|---|
| PubChem CID | 174756001 |
| Molecular Formula | C9H13ClNNaO3 |
| Molecular Weight | 241.65 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | sodium;4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;chloride |
| SMILES | CNC[C@H](O)c1ccc(O)c(O)c1.[Cl-].[Na+] |
| InChI | InChI=1S/C9H13NO3.ClH.Na/c1-10-5-9(13)6-2-3-7(11)8(12)4-6;;/h2-4,9-13H,5H2,1H3;1H;/q;;+1/p-1/t9-;;/m0../s1 |
| InChIKey | AXDRCTRUIXTTOH-WWPIYYJJSA-M |
| XLogP | -5.64 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.65 |
| LogP ≤ 5 | -5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|