C12H17NO7 — CID 146306053
4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;propanedioic acid (PubChem CID 146306053) has the molecular formula C12H17NO7 and a molecular weight of 287.27 g/mol. Its IUPAC name is 4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;propanedioic acid.
| Compound Name | 4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;propanedioic acid |
|---|---|
| PubChem CID | 146306053 |
| Molecular Formula | C12H17NO7 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;propanedioic acid |
| SMILES | CNCC(O)c1ccc(O)c(O)c1.O=C(O)CC(=O)O |
| InChI | InChI=1S/C9H13NO3.C3H4O4/c1-10-5-9(13)6-2-3-7(11)8(12)4-6;4-2(5)1-3(6)7/h2-4,9-13H,5H2,1H3;1H2,(H,4,5)(H,6,7) |
| InChIKey | KVSQTCOQFBHZEK-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|