C15H22O4 — CID 78931750
(1S)-1-[3-methoxy-4-(oxan-4-ylmethoxy)phenyl]ethanol (PubChem CID 78931750) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (1S)-1-[3-methoxy-4-(oxan-4-ylmethoxy)phenyl]ethanol.
| Compound Name | (1S)-1-[3-methoxy-4-(oxan-4-ylmethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 78931750 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (1S)-1-[3-methoxy-4-(oxan-4-ylmethoxy)phenyl]ethanol |
| SMILES | COc1cc([C@H](C)O)ccc1OCC1CCOCC1 |
| InChI | InChI=1S/C15H22O4/c1-11(16)13-3-4-14(15(9-13)17-2)19-10-12-5-7-18-8-6-12/h3-4,9,11-12,16H,5-8,10H2,1-2H3/t11-/m0/s1 |
| InChIKey | YCXCQGAHFYRTRQ-NSHDSACASA-N |
| XLogP | 2.55 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |