C16H24O4 — CID 65162787
(1R)-1-[3-methoxy-4-[3-(oxolan-2-yl)propoxy]phenyl]ethanol (PubChem CID 65162787) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (1R)-1-[3-methoxy-4-[3-(oxolan-2-yl)propoxy]phenyl]ethanol.
| Compound Name | (1R)-1-[3-methoxy-4-[3-(oxolan-2-yl)propoxy]phenyl]ethanol |
|---|---|
| PubChem CID | 65162787 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (1R)-1-[3-methoxy-4-[3-(oxolan-2-yl)propoxy]phenyl]ethanol |
| SMILES | COc1cc([C@@H](C)O)ccc1OCCCC1CCCO1 |
| InChI | InChI=1S/C16H24O4/c1-12(17)13-7-8-15(16(11-13)18-2)20-10-4-6-14-5-3-9-19-14/h7-8,11-12,14,17H,3-6,9-10H2,1-2H3/t12-,14?/m1/s1 |
| InChIKey | XKRBYJYCSAHRTM-PUODRLBUSA-N |
| XLogP | 3.09 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|