C14H20O4 — CID 62606269
1-(3,4-dimethoxyphenyl)-2-(oxolan-2-yl)ethanol (PubChem CID 62606269) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-(oxolan-2-yl)ethanol.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-(oxolan-2-yl)ethanol |
|---|---|
| PubChem CID | 62606269 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-(oxolan-2-yl)ethanol |
| SMILES | COc1ccc(C(O)CC2CCCO2)cc1OC |
| InChI | InChI=1S/C14H20O4/c1-16-13-6-5-10(8-14(13)17-2)12(15)9-11-4-3-7-18-11/h5-6,8,11-12,15H,3-4,7,9H2,1-2H3 |
| InChIKey | HRJXEBKVJLOQTF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |