C14H20O5 — CID 13252940
1-[3-methoxy-4-(oxan-2-yloxy)phenyl]ethane-1,2-diol (PubChem CID 13252940) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-[3-methoxy-4-(oxan-2-yloxy)phenyl]ethane-1,2-diol.
| Compound Name | 1-[3-methoxy-4-(oxan-2-yloxy)phenyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 13252940 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 1-[3-methoxy-4-(oxan-2-yloxy)phenyl]ethane-1,2-diol |
| SMILES | COc1cc(C(O)CO)ccc1OC1CCCCO1 |
| InChI | InChI=1S/C14H20O5/c1-17-13-8-10(11(16)9-15)5-6-12(13)19-14-4-2-3-7-18-14/h5-6,8,11,14-16H,2-4,7,9H2,1H3 |
| InChIKey | WWTMRXLYXRIGTG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |