C15H21NO3S — CID 65160952
3-methoxy-4-[3-(oxolan-2-yl)propoxy]benzenecarbothioamide (PubChem CID 65160952) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is 3-methoxy-4-[3-(oxolan-2-yl)propoxy]benzenecarbothioamide.
| Compound Name | 3-methoxy-4-[3-(oxolan-2-yl)propoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 65160952 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 3-methoxy-4-[3-(oxolan-2-yl)propoxy]benzenecarbothioamide |
| SMILES | COc1cc(C(N)=S)ccc1OCCCC1CCCO1 |
| InChI | InChI=1S/C15H21NO3S/c1-17-14-10-11(15(16)20)6-7-13(14)19-9-3-5-12-4-2-8-18-12/h6-7,10,12H,2-5,8-9H2,1H3,(H2,16,20) |
| InChIKey | OCMNOLVJBSYUOM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|