C15H24ClNO3 — CID 171243693
(S)-(4-ethoxy-3-methoxyphenyl)-(oxan-4-yl)methanamine;hydrochloride (PubChem CID 171243693) has the molecular formula C15H24ClNO3 and a molecular weight of 301.81 g/mol. Its IUPAC name is (S)-(4-ethoxy-3-methoxyphenyl)-(oxan-4-yl)methanamine;hydrochloride.
| Compound Name | (S)-(4-ethoxy-3-methoxyphenyl)-(oxan-4-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171243693 |
| Molecular Formula | C15H24ClNO3 |
| Molecular Weight | 301.81 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | (S)-(4-ethoxy-3-methoxyphenyl)-(oxan-4-yl)methanamine;hydrochloride |
| SMILES | CCOc1ccc([C@@H](N)C2CCOCC2)cc1OC.Cl |
| InChI | InChI=1S/C15H23NO3.ClH/c1-3-19-13-5-4-12(10-14(13)17-2)15(16)11-6-8-18-9-7-11;/h4-5,10-11,15H,3,6-9,16H2,1-2H3;1H/t15-;/m0./s1 |
| InChIKey | UKIBMTCMKYCGII-RSAXXLAASA-N |
| XLogP | 2.94 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.81 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |