C17H24O3 — CID 63900983
cyclohex-3-en-1-yl-(3,4-diethoxyphenyl)methanol (PubChem CID 63900983) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is cyclohex-3-en-1-yl-(3,4-diethoxyphenyl)methanol.
| Compound Name | cyclohex-3-en-1-yl-(3,4-diethoxyphenyl)methanol |
|---|---|
| PubChem CID | 63900983 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | cyclohex-3-en-1-yl-(3,4-diethoxyphenyl)methanol |
| SMILES | CCOc1ccc(C(O)C2CC=CCC2)cc1OCC |
| InChI | InChI=1S/C17H24O3/c1-3-19-15-11-10-14(12-16(15)20-4-2)17(18)13-8-6-5-7-9-13/h5-6,10-13,17-18H,3-4,7-9H2,1-2H3 |
| InChIKey | BDMQJDHSFFEIPP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|