C12H18ClNO4 — CID 57432823
4-amino-3-(3,4-dimethoxyphenyl)butanoic acid;hydrochloride (PubChem CID 57432823) has the molecular formula C12H18ClNO4 and a molecular weight of 275.73 g/mol. Its IUPAC name is 4-amino-3-(3,4-dimethoxyphenyl)butanoic acid;hydrochloride.
| Compound Name | 4-amino-3-(3,4-dimethoxyphenyl)butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 57432823 |
| Molecular Formula | C12H18ClNO4 |
| Molecular Weight | 275.73 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 4-amino-3-(3,4-dimethoxyphenyl)butanoic acid;hydrochloride |
| SMILES | COc1ccc(C(CN)CC(=O)O)cc1OC.Cl |
| InChI | InChI=1S/C12H17NO4.ClH/c1-16-10-4-3-8(5-11(10)17-2)9(7-13)6-12(14)15;/h3-5,9H,6-7,13H2,1-2H3,(H,14,15);1H |
| InChIKey | SAPSUFQXMXHFCR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.73 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |