C17H27NO4 — CID 59914280
tert-butyl (4S)-5-amino-4-(3,4-dimethoxyphenyl)pentanoate (PubChem CID 59914280) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is tert-butyl (4S)-5-amino-4-(3,4-dimethoxyphenyl)pentanoate.
| Compound Name | tert-butyl (4S)-5-amino-4-(3,4-dimethoxyphenyl)pentanoate |
|---|---|
| PubChem CID | 59914280 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | tert-butyl (4S)-5-amino-4-(3,4-dimethoxyphenyl)pentanoate |
| SMILES | COc1ccc([C@@H](CN)CCC(=O)OC(C)(C)C)cc1OC |
| InChI | InChI=1S/C17H27NO4/c1-17(2,3)22-16(19)9-7-13(11-18)12-6-8-14(20-4)15(10-12)21-5/h6,8,10,13H,7,9,11,18H2,1-5H3/t13-/m1/s1 |
| InChIKey | SRKJTUBCDVKQMO-CYBMUJFWSA-N |
| XLogP | 2.87 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |