C28H49BO6Si — CID 59914208
tert-butyl (4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentanoate (PubChem CID 59914208) has the molecular formula C28H49BO6Si and a molecular weight of 520.59 g/mol. Its IUPAC name is tert-butyl (4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentanoate.
| Compound Name | tert-butyl (4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentanoate |
|---|---|
| PubChem CID | 59914208 |
| Molecular Formula | C28H49BO6Si |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.34 |
| IUPAC Name | tert-butyl (4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pentanoate |
| SMILES | COc1ccc([C@H](CCC(=O)OC(C)(C)C)CO[Si](C)(C)C(C)(C)C)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C28H49BO6Si/c1-25(2,3)33-24(30)17-15-21(19-32-36(12,13)26(4,5)6)20-14-16-23(31-11)22(18-20)29-34-27(7,8)28(9,10)35-29/h14,16,18,21H,15,17,19H2,1-13H3/t21-/m1/s1 |
| InChIKey | PIAMUQHFDUIEAS-OAQYLSRUSA-N |
| XLogP | 6.22 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|