C13H20O4 — CID 15691833
3-(3,4-dimethoxyphenyl)pentane-1,5-diol (PubChem CID 15691833) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)pentane-1,5-diol.
| Compound Name | 3-(3,4-dimethoxyphenyl)pentane-1,5-diol |
|---|---|
| PubChem CID | 15691833 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)pentane-1,5-diol |
| SMILES | COc1ccc(C(CCO)CCO)cc1OC |
| InChI | InChI=1S/C13H20O4/c1-16-12-4-3-11(9-13(12)17-2)10(5-7-14)6-8-15/h3-4,9-10,14-15H,5-8H2,1-2H3 |
| InChIKey | GETTUDYTEUCTIT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |