C16H23F2NO3 — CID 142451403
tert-butyl 5-amino-4-[2-(difluoromethoxy)phenyl]pentanoate (PubChem CID 142451403) has the molecular formula C16H23F2NO3 and a molecular weight of 315.36 g/mol. Its IUPAC name is tert-butyl 5-amino-4-[2-(difluoromethoxy)phenyl]pentanoate.
| Compound Name | tert-butyl 5-amino-4-[2-(difluoromethoxy)phenyl]pentanoate |
|---|---|
| PubChem CID | 142451403 |
| Molecular Formula | C16H23F2NO3 |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | tert-butyl 5-amino-4-[2-(difluoromethoxy)phenyl]pentanoate |
| SMILES | CC(C)(C)OC(=O)CCC(CN)c1ccccc1OC(F)F |
| InChI | InChI=1S/C16H23F2NO3/c1-16(2,3)22-14(20)9-8-11(10-19)12-6-4-5-7-13(12)21-15(17)18/h4-7,11,15H,8-10,19H2,1-3H3 |
| InChIKey | LGXDHWXQVIFGGI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |