C16H22F3NO3 — CID 146368484
1-fluorobutyl 5-amino-4-[2-(difluoromethoxy)phenyl]pentanoate (PubChem CID 146368484) has the molecular formula C16H22F3NO3 and a molecular weight of 333.35 g/mol. Its IUPAC name is 1-fluorobutyl 5-amino-4-[2-(difluoromethoxy)phenyl]pentanoate.
| Compound Name | 1-fluorobutyl 5-amino-4-[2-(difluoromethoxy)phenyl]pentanoate |
|---|---|
| PubChem CID | 146368484 |
| Molecular Formula | C16H22F3NO3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 1-fluorobutyl 5-amino-4-[2-(difluoromethoxy)phenyl]pentanoate |
| SMILES | CCCC(F)OC(=O)CCC(CN)c1ccccc1OC(F)F |
| InChI | InChI=1S/C16H22F3NO3/c1-2-5-14(17)23-15(21)9-8-11(10-20)12-6-3-4-7-13(12)22-16(18)19/h3-4,6-7,11,14,16H,2,5,8-10,20H2,1H3 |
| InChIKey | KJLRJPMUMGCHID-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |