C13H19FN2O2 — CID 146368456
1-fluorobutyl 4-amino-3-pyridin-2-ylbutanoate (PubChem CID 146368456) has the molecular formula C13H19FN2O2 and a molecular weight of 254.31 g/mol. Its IUPAC name is 1-fluorobutyl 4-amino-3-pyridin-2-ylbutanoate.
| Compound Name | 1-fluorobutyl 4-amino-3-pyridin-2-ylbutanoate |
|---|---|
| PubChem CID | 146368456 |
| Molecular Formula | C13H19FN2O2 |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 1-fluorobutyl 4-amino-3-pyridin-2-ylbutanoate |
| SMILES | CCCC(F)OC(=O)CC(CN)c1ccccn1 |
| InChI | InChI=1S/C13H19FN2O2/c1-2-5-12(14)18-13(17)8-10(9-15)11-6-3-4-7-16-11/h3-4,6-7,10,12H,2,5,8-9,15H2,1H3 |
| InChIKey | WBGDEJXYTJTQHL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |