C13H22N2 — CID 95241708
(2R,4S)-4-methyl-2-pyridin-2-ylheptan-1-amine (PubChem CID 95241708) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is (2R,4S)-4-methyl-2-pyridin-2-ylheptan-1-amine.
| Compound Name | (2R,4S)-4-methyl-2-pyridin-2-ylheptan-1-amine |
|---|---|
| PubChem CID | 95241708 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | (2R,4S)-4-methyl-2-pyridin-2-ylheptan-1-amine |
| SMILES | CCC[C@H](C)C[C@H](CN)c1ccccn1 |
| InChI | InChI=1S/C13H22N2/c1-3-6-11(2)9-12(10-14)13-7-4-5-8-15-13/h4-5,7-8,11-12H,3,6,9-10,14H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | LXHNDOBPADIHQV-NWDGAFQWSA-N |
| XLogP | 2.95 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |