About ethane;2-pentan-3-ylpyridine
ethane;2-pentan-3-ylpyridine (PubChem CID 142883968) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is ethane;2-pentan-3-ylpyridine.
Molecular Properties
| Compound Name | ethane;2-pentan-3-ylpyridine |
| PubChem CID | 142883968 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | ethane;2-pentan-3-ylpyridine |
| SMILES | CC.CCC(CC)c1ccccn1 |
| InChI | InChI=1S/C10H15N.C2H6/c1-3-9(4-2)10-7-5-6-8-11-10;1-2/h5-9H,3-4H2,1-2H3;1-2H3 |
| InChIKey | BBLKQXHNDBQRIF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-pentan-3-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-pentan-3-ylpyridine?
The IUPAC name of ethane;2-pentan-3-ylpyridine (CID 142883968) is ethane;2-pentan-3-ylpyridine.
What is the SMILES notation for ethane;2-pentan-3-ylpyridine?
The canonical SMILES for ethane;2-pentan-3-ylpyridine is CC.CCC(CC)c1ccccn1.
What is the InChIKey of ethane;2-pentan-3-ylpyridine?
The InChIKey is BBLKQXHNDBQRIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.C2H6/c1-3-9(4-2)10-7-5-6-8-11-10;1-2/h5-9H,3-4H2,1-2H3;1-2H3.
What are the key properties of ethane;2-pentan-3-ylpyridine?
ethane;2-pentan-3-ylpyridine has a molecular weight of 179.31 g/mol, XLogP of 4.01, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-pentan-3-ylpyridine is sourced from PubChem (CID 142883968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).