About 2-tridecan-6-ylpyridine
2-tridecan-6-ylpyridine (PubChem CID 139295924) has the molecular formula C18H31N
and a molecular weight of 261.45 g/mol. Its IUPAC name is 2-tridecan-6-ylpyridine.
Molecular Properties
| Compound Name | 2-tridecan-6-ylpyridine |
| PubChem CID | 139295924 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 2-tridecan-6-ylpyridine |
| SMILES | CCCCCCCC(CCCCC)c1ccccn1 |
| InChI | InChI=1S/C18H31N/c1-3-5-7-8-10-14-17(13-9-6-4-2)18-15-11-12-16-19-18/h11-12,15-17H,3-10,13-14H2,1-2H3 |
| InChIKey | ATQMACJXAIFZQG-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-tridecan-6-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tridecan-6-ylpyridine?
The IUPAC name of 2-tridecan-6-ylpyridine (CID 139295924) is 2-tridecan-6-ylpyridine.
What is the SMILES notation for 2-tridecan-6-ylpyridine?
The canonical SMILES for 2-tridecan-6-ylpyridine is CCCCCCCC(CCCCC)c1ccccn1.
What is the InChIKey of 2-tridecan-6-ylpyridine?
The InChIKey is ATQMACJXAIFZQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31N/c1-3-5-7-8-10-14-17(13-9-6-4-2)18-15-11-12-16-19-18/h11-12,15-17H,3-10,13-14H2,1-2H3.
What are the key properties of 2-tridecan-6-ylpyridine?
2-tridecan-6-ylpyridine has a molecular weight of 261.45 g/mol, XLogP of 6.11, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tridecan-6-ylpyridine is sourced from PubChem (CID 139295924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).