About 2-(1-bromohexadecyl)pyridine;hydrate
2-(1-bromohexadecyl)pyridine;hydrate (PubChem CID 175001127) has the molecular formula C21H38BrNO
and a molecular weight of 400.45 g/mol. Its IUPAC name is 2-(1-bromohexadecyl)pyridine;hydrate.
Molecular Properties
| Compound Name | 2-(1-bromohexadecyl)pyridine;hydrate |
| PubChem CID | 175001127 |
| Molecular Formula | C21H38BrNO |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 2-(1-bromohexadecyl)pyridine;hydrate |
| SMILES | CCCCCCCCCCCCCCCC(Br)c1ccccn1.O |
| InChI | InChI=1S/C21H36BrN.H2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-20(22)21-18-15-16-19-23-21;/h15-16,18-20H,2-14,17H2,1H3;1H2 |
| InChIKey | FBXFBZPOGAWRGX-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 44.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-bromohexadecyl)pyridine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-bromohexadecyl)pyridine;hydrate?
The IUPAC name of 2-(1-bromohexadecyl)pyridine;hydrate (CID 175001127) is 2-(1-bromohexadecyl)pyridine;hydrate.
What is the SMILES notation for 2-(1-bromohexadecyl)pyridine;hydrate?
The canonical SMILES for 2-(1-bromohexadecyl)pyridine;hydrate is CCCCCCCCCCCCCCCC(Br)c1ccccn1.O.
What is the InChIKey of 2-(1-bromohexadecyl)pyridine;hydrate?
The InChIKey is FBXFBZPOGAWRGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36BrN.H2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17-20(22)21-18-15-16-19-23-21;/h15-16,18-20H,2-14,17H2,1H3;1H2.
What are the key properties of 2-(1-bromohexadecyl)pyridine;hydrate?
2-(1-bromohexadecyl)pyridine;hydrate has a molecular weight of 400.45 g/mol, XLogP of 7.17, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-bromohexadecyl)pyridine;hydrate is sourced from PubChem (CID 175001127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).