About 2-heptan-4-ylpyridine;4-hexan-3-ylpyridazine
2-heptan-4-ylpyridine;4-hexan-3-ylpyridazine (PubChem CID 177190805) has the molecular formula C22H35N3
and a molecular weight of 341.54 g/mol. Its IUPAC name is 2-heptan-4-ylpyridine;4-hexan-3-ylpyridazine.
Molecular Properties
| Compound Name | 2-heptan-4-ylpyridine;4-hexan-3-ylpyridazine |
| PubChem CID | 177190805 |
| Molecular Formula | C22H35N3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.28 |
| IUPAC Name | 2-heptan-4-ylpyridine;4-hexan-3-ylpyridazine |
| SMILES | CCCC(CC)c1ccnnc1.CCCC(CCC)c1ccccn1 |
| InChI | InChI=1S/C12H19N.C10H16N2/c1-3-7-11(8-4-2)12-9-5-6-10-13-12;1-3-5-9(4-2)10-6-7-11-12-8-10/h5-6,9-11H,3-4,7-8H2,1-2H3;6-9H,3-5H2,1-2H3 |
| InChIKey | URJIRLNOBCTFEV-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-heptan-4-ylpyridine;4-hexan-3-ylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptan-4-ylpyridine;4-hexan-3-ylpyridazine?
The IUPAC name of 2-heptan-4-ylpyridine;4-hexan-3-ylpyridazine (CID 177190805) is 2-heptan-4-ylpyridine;4-hexan-3-ylpyridazine.
What is the SMILES notation for 2-heptan-4-ylpyridine;4-hexan-3-ylpyridazine?
The canonical SMILES for 2-heptan-4-ylpyridine;4-hexan-3-ylpyridazine is CCCC(CC)c1ccnnc1.CCCC(CCC)c1ccccn1.
What is the InChIKey of 2-heptan-4-ylpyridine;4-hexan-3-ylpyridazine?
The InChIKey is URJIRLNOBCTFEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N.C10H16N2/c1-3-7-11(8-4-2)12-9-5-6-10-13-12;1-3-5-9(4-2)10-6-7-11-12-8-10/h5-6,9-11H,3-4,7-8H2,1-2H3;6-9H,3-5H2,1-2H3.
What are the key properties of 2-heptan-4-ylpyridine;4-hexan-3-ylpyridazine?
2-heptan-4-ylpyridine;4-hexan-3-ylpyridazine has a molecular weight of 341.54 g/mol, XLogP of 6.54, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptan-4-ylpyridine;4-hexan-3-ylpyridazine is sourced from PubChem (CID 177190805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).