C16H21F4NO3 — CID 146368383
1-fluorobutyl 5-amino-4-[2-(trifluoromethoxy)phenyl]pentanoate (PubChem CID 146368383) has the molecular formula C16H21F4NO3 and a molecular weight of 351.34 g/mol. Its IUPAC name is 1-fluorobutyl 5-amino-4-[2-(trifluoromethoxy)phenyl]pentanoate.
| Compound Name | 1-fluorobutyl 5-amino-4-[2-(trifluoromethoxy)phenyl]pentanoate |
|---|---|
| PubChem CID | 146368383 |
| Molecular Formula | C16H21F4NO3 |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 1-fluorobutyl 5-amino-4-[2-(trifluoromethoxy)phenyl]pentanoate |
| SMILES | CCCC(F)OC(=O)CCC(CN)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C16H21F4NO3/c1-2-5-14(17)23-15(22)9-8-11(10-21)12-6-3-4-7-13(12)24-16(18,19)20/h3-4,6-7,11,14H,2,5,8-10,21H2,1H3 |
| InChIKey | AXMVGJKFIJTESJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |