C16H17F4NO2 — CID 146368302
1-fluorobutyl 4-cyano-4-[2-(trifluoromethyl)phenyl]butanoate (PubChem CID 146368302) has the molecular formula C16H17F4NO2 and a molecular weight of 331.31 g/mol. Its IUPAC name is 1-fluorobutyl 4-cyano-4-[2-(trifluoromethyl)phenyl]butanoate.
| Compound Name | 1-fluorobutyl 4-cyano-4-[2-(trifluoromethyl)phenyl]butanoate |
|---|---|
| PubChem CID | 146368302 |
| Molecular Formula | C16H17F4NO2 |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 1-fluorobutyl 4-cyano-4-[2-(trifluoromethyl)phenyl]butanoate |
| SMILES | CCCC(F)OC(=O)CCC(C#N)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H17F4NO2/c1-2-5-14(17)23-15(22)9-8-11(10-21)12-6-3-4-7-13(12)16(18,19)20/h3-4,6-7,11,14H,2,5,8-9H2,1H3 |
| InChIKey | NUJJATDFZLKZKV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |