1-fluorobutyl 4-cyano-4-[2-(trifluoromethyl)phenyl]butanoate

C16H17F4NO2 — CID 146368302

IUPAC1-fluorobutyl 4-cyano-4-[2-(trifluoromethyl)phenyl]butanoate
SMILESCCCC(F)OC(=O)CCC(C#N)c1ccccc1C(F)(F)F
InChIInChI=1S/C16H17F4NO2/c1-2-5-14(17)23-15(22)9-8-11(10-21)12-6-3-4-7-13(12)16(18,19)20/h3-4,6-7,11,14H,2,5,8-9H2,1H3
InChIKeyNUJJATDFZLKZKV-UHFFFAOYSA-N
MW331.31 g/mol
LogP4.73
Rot. Bonds7

About 1-fluorobutyl 4-cyano-4-[2-(trifluoromethyl)phenyl]butanoate

1-fluorobutyl 4-cyano-4-[2-(trifluoromethyl)phenyl]butanoate (PubChem CID 146368302) has the molecular formula C16H17F4NO2 and a molecular weight of 331.31 g/mol. Its IUPAC name is 1-fluorobutyl 4-cyano-4-[2-(trifluoromethyl)phenyl]butanoate.

Molecular Properties

Compound Name1-fluorobutyl 4-cyano-4-[2-(trifluoromethyl)phenyl]butanoate
PubChem CID146368302
Molecular FormulaC16H17F4NO2
Molecular Weight331.31 g/mol
Exact Mass331.12
IUPAC Name1-fluorobutyl 4-cyano-4-[2-(trifluoromethyl)phenyl]butanoate
SMILESCCCC(F)OC(=O)CCC(C#N)c1ccccc1C(F)(F)F
InChIInChI=1S/C16H17F4NO2/c1-2-5-14(17)23-15(22)9-8-11(10-21)12-6-3-4-7-13(12)16(18,19)20/h3-4,6-7,11,14H,2,5,8-9H2,1H3
InChIKeyNUJJATDFZLKZKV-UHFFFAOYSA-N
XLogP4.73
TPSA50.09 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500331.31
LogP ≤ 54.73
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 1-fluorobutyl 4-cyano-4-[2-(trifluoromethyl)phenyl]butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-fluorobutyl 4-cyano-4-[2-(trifluoromethyl)phenyl]butanoate?
The IUPAC name of 1-fluorobutyl 4-cyano-4-[2-(trifluoromethyl)phenyl]butanoate (CID 146368302) is 1-fluorobutyl 4-cyano-4-[2-(trifluoromethyl)phenyl]butanoate.
What is the SMILES notation for 1-fluorobutyl 4-cyano-4-[2-(trifluoromethyl)phenyl]butanoate?
The canonical SMILES for 1-fluorobutyl 4-cyano-4-[2-(trifluoromethyl)phenyl]butanoate is CCCC(F)OC(=O)CCC(C#N)c1ccccc1C(F)(F)F.
What is the InChIKey of 1-fluorobutyl 4-cyano-4-[2-(trifluoromethyl)phenyl]butanoate?
The InChIKey is NUJJATDFZLKZKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F4NO2/c1-2-5-14(17)23-15(22)9-8-11(10-21)12-6-3-4-7-13(12)16(18,19)20/h3-4,6-7,11,14H,2,5,8-9H2,1H3.
What are the key properties of 1-fluorobutyl 4-cyano-4-[2-(trifluoromethyl)phenyl]butanoate?
1-fluorobutyl 4-cyano-4-[2-(trifluoromethyl)phenyl]butanoate has a molecular weight of 331.31 g/mol, XLogP of 4.73, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluorobutyl 4-cyano-4-[2-(trifluoromethyl)phenyl]butanoate is sourced from PubChem (CID 146368302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).