C15H21ClFNO2 — CID 146368493
1-fluorobutyl 4-amino-3-(2-chlorophenyl)-3-methylbutanoate (PubChem CID 146368493) has the molecular formula C15H21ClFNO2 and a molecular weight of 301.79 g/mol. Its IUPAC name is 1-fluorobutyl 4-amino-3-(2-chlorophenyl)-3-methylbutanoate.
| Compound Name | 1-fluorobutyl 4-amino-3-(2-chlorophenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 146368493 |
| Molecular Formula | C15H21ClFNO2 |
| Molecular Weight | 301.79 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-fluorobutyl 4-amino-3-(2-chlorophenyl)-3-methylbutanoate |
| SMILES | CCCC(F)OC(=O)CC(C)(CN)c1ccccc1Cl |
| InChI | InChI=1S/C15H21ClFNO2/c1-3-6-13(17)20-14(19)9-15(2,10-18)11-7-4-5-8-12(11)16/h4-5,7-8,13H,3,6,9-10,18H2,1-2H3 |
| InChIKey | FTGGLDGDDLIRKM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.79 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |