C17H25ClFNO2 — CID 146368436
1-fluorobutyl 6-amino-5-(2-chlorophenyl)-5-methylhexanoate (PubChem CID 146368436) has the molecular formula C17H25ClFNO2 and a molecular weight of 329.84 g/mol. Its IUPAC name is 1-fluorobutyl 6-amino-5-(2-chlorophenyl)-5-methylhexanoate.
| Compound Name | 1-fluorobutyl 6-amino-5-(2-chlorophenyl)-5-methylhexanoate |
|---|---|
| PubChem CID | 146368436 |
| Molecular Formula | C17H25ClFNO2 |
| Molecular Weight | 329.84 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 1-fluorobutyl 6-amino-5-(2-chlorophenyl)-5-methylhexanoate |
| SMILES | CCCC(F)OC(=O)CCCC(C)(CN)c1ccccc1Cl |
| InChI | InChI=1S/C17H25ClFNO2/c1-3-7-15(19)22-16(21)10-6-11-17(2,12-20)13-8-4-5-9-14(13)18/h4-5,8-9,15H,3,6-7,10-12,20H2,1-2H3 |
| InChIKey | ZDQARAIFVJSAIB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.84 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |