C17H27NO2 — CID 153407915
tert-butyl 6-amino-5-methyl-5-phenylhexanoate (PubChem CID 153407915) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is tert-butyl 6-amino-5-methyl-5-phenylhexanoate.
| Compound Name | tert-butyl 6-amino-5-methyl-5-phenylhexanoate |
|---|---|
| PubChem CID | 153407915 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | tert-butyl 6-amino-5-methyl-5-phenylhexanoate |
| SMILES | CC(C)(C)OC(=O)CCCC(C)(CN)c1ccccc1 |
| InChI | InChI=1S/C17H27NO2/c1-16(2,3)20-15(19)11-8-12-17(4,13-18)14-9-6-5-7-10-14/h5-7,9-10H,8,11-13,18H2,1-4H3 |
| InChIKey | OOBZHFSSUIYBNQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |