C29H35NO4 — CID 25179992
tert-butyl 4-[4-[[4-(dimethylamino)phenyl]-hydroxy-phenylmethyl]phenoxy]butanoate (PubChem CID 25179992) has the molecular formula C29H35NO4 and a molecular weight of 461.60 g/mol. Its IUPAC name is tert-butyl 4-[4-[[4-(dimethylamino)phenyl]-hydroxy-phenylmethyl]phenoxy]butanoate.
| Compound Name | tert-butyl 4-[4-[[4-(dimethylamino)phenyl]-hydroxy-phenylmethyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 25179992 |
| Molecular Formula | C29H35NO4 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | tert-butyl 4-[4-[[4-(dimethylamino)phenyl]-hydroxy-phenylmethyl]phenoxy]butanoate |
| SMILES | CN(C)c1ccc(C(O)(c2ccccc2)c2ccc(OCCCC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H35NO4/c1-28(2,3)34-27(31)12-9-21-33-26-19-15-24(16-20-26)29(32,22-10-7-6-8-11-22)23-13-17-25(18-14-23)30(4)5/h6-8,10-11,13-20,32H,9,12,21H2,1-5H3 |
| InChIKey | QDWDOTVZUGDQKL-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|