C30H37NO7 — CID 143202973
acetic acid;4-[4-[[4-(dimethylamino)phenyl]-hydroxy-(4-propoxyphenyl)methyl]phenoxy]butanoic acid (PubChem CID 143202973) has the molecular formula C30H37NO7 and a molecular weight of 523.63 g/mol. Its IUPAC name is acetic acid;4-[4-[[4-(dimethylamino)phenyl]-hydroxy-(4-propoxyphenyl)methyl]phenoxy]butanoic acid.
| Compound Name | acetic acid;4-[4-[[4-(dimethylamino)phenyl]-hydroxy-(4-propoxyphenyl)methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 143202973 |
| Molecular Formula | C30H37NO7 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | acetic acid;4-[4-[[4-(dimethylamino)phenyl]-hydroxy-(4-propoxyphenyl)methyl]phenoxy]butanoic acid |
| SMILES | CC(=O)O.CCCOc1ccc(C(O)(c2ccc(OCCCC(=O)O)cc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H33NO5.C2H4O2/c1-4-19-33-25-15-9-22(10-16-25)28(32,21-7-13-24(14-8-21)29(2)3)23-11-17-26(18-12-23)34-20-5-6-27(30)31;1-2(3)4/h7-18,32H,4-6,19-20H2,1-3H3,(H,30,31);1H3,(H,3,4) |
| InChIKey | AJRUPXNSKSVIHP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|