C37H49NO7 — CID 23069535
tert-butyl 4-[4-[[4-(dimethylamino)phenyl]-hydroxy-[4-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]phenyl]methyl]phenoxy]butanoate (PubChem CID 23069535) has the molecular formula C37H49NO7 and a molecular weight of 619.80 g/mol. Its IUPAC name is tert-butyl 4-[4-[[4-(dimethylamino)phenyl]-hydroxy-[4-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]phenyl]methyl]phenoxy]butanoate.
| Compound Name | tert-butyl 4-[4-[[4-(dimethylamino)phenyl]-hydroxy-[4-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]phenyl]methyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 23069535 |
| Molecular Formula | C37H49NO7 |
| Molecular Weight | 619.80 g/mol |
| Exact Mass | 619.35 |
| IUPAC Name | tert-butyl 4-[4-[[4-(dimethylamino)phenyl]-hydroxy-[4-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]phenyl]methyl]phenoxy]butanoate |
| SMILES | CN(C)c1ccc(C(O)(c2ccc(OCCCC(=O)OC(C)(C)C)cc2)c2ccc(OCCCC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C37H49NO7/c1-35(2,3)44-33(39)11-9-25-42-31-21-15-28(16-22-31)37(41,27-13-19-30(20-14-27)38(7)8)29-17-23-32(24-18-29)43-26-10-12-34(40)45-36(4,5)6/h13-24,41H,9-12,25-26H2,1-8H3 |
| InChIKey | PSIIBHADRQPMSU-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.80 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|