C32H40NO6S+ — CID 18381187
[4-(dimethylamino)phenyl]-bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium (PubChem CID 18381187) has the molecular formula C32H40NO6S+ and a molecular weight of 566.74 g/mol. Its IUPAC name is [4-(dimethylamino)phenyl]-bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium.
| Compound Name | [4-(dimethylamino)phenyl]-bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 18381187 |
| Molecular Formula | C32H40NO6S+ |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | [4-(dimethylamino)phenyl]-bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]sulfanium |
| SMILES | CN(C)c1ccc([S+](c2ccc(OCC(=O)OC(C)(C)C)cc2)c2ccc(OCC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C32H40NO6S/c1-31(2,3)38-29(34)21-36-24-11-17-27(18-12-24)40(26-15-9-23(10-16-26)33(7)8)28-19-13-25(14-20-28)37-22-30(35)39-32(4,5)6/h9-20H,21-22H2,1-8H3/q+1 |
| InChIKey | FMSQNRMGWWPLAI-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|