C16H25ClFNO3 — CID 146368517
1-fluorobutyl 4-amino-3-(2-ethoxyphenyl)butanoate;hydrochloride (PubChem CID 146368517) has the molecular formula C16H25ClFNO3 and a molecular weight of 333.83 g/mol. Its IUPAC name is 1-fluorobutyl 4-amino-3-(2-ethoxyphenyl)butanoate;hydrochloride.
| Compound Name | 1-fluorobutyl 4-amino-3-(2-ethoxyphenyl)butanoate;hydrochloride |
|---|---|
| PubChem CID | 146368517 |
| Molecular Formula | C16H25ClFNO3 |
| Molecular Weight | 333.83 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 1-fluorobutyl 4-amino-3-(2-ethoxyphenyl)butanoate;hydrochloride |
| SMILES | CCCC(F)OC(=O)CC(CN)c1ccccc1OCC.Cl |
| InChI | InChI=1S/C16H24FNO3.ClH/c1-3-7-15(17)21-16(19)10-12(11-18)13-8-5-6-9-14(13)20-4-2;/h5-6,8-9,12,15H,3-4,7,10-11,18H2,1-2H3;1H |
| InChIKey | DGOYGGKPSHSGPZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.83 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |