C13H18ClFN2O2 — CID 146368562
1-fluorobutyl 3-amino-2-(3-chloro-2-pyridinyl)-2-methylpropanoate (PubChem CID 146368562) has the molecular formula C13H18ClFN2O2 and a molecular weight of 288.75 g/mol. Its IUPAC name is 1-fluorobutyl 3-amino-2-(3-chloro-2-pyridinyl)-2-methylpropanoate.
| Compound Name | 1-fluorobutyl 3-amino-2-(3-chloro-2-pyridinyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 146368562 |
| Molecular Formula | C13H18ClFN2O2 |
| Molecular Weight | 288.75 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 1-fluorobutyl 3-amino-2-(3-chloro-2-pyridinyl)-2-methylpropanoate |
| SMILES | CCCC(F)OC(=O)C(C)(CN)c1ncccc1Cl |
| InChI | InChI=1S/C13H18ClFN2O2/c1-3-5-10(15)19-12(18)13(2,8-16)11-9(14)6-4-7-17-11/h4,6-7,10H,3,5,8,16H2,1-2H3 |
| InChIKey | SQMXRCVPBBNCTQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.75 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |