About 1-pyridin-2-ylethyl propanoate
1-pyridin-2-ylethyl propanoate (PubChem CID 141268318) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-pyridin-2-ylethyl propanoate.
Molecular Properties
| Compound Name | 1-pyridin-2-ylethyl propanoate |
| PubChem CID | 141268318 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-pyridin-2-ylethyl propanoate |
| SMILES | CCC(=O)OC(C)c1ccccn1 |
| InChI | InChI=1S/C10H13NO2/c1-3-10(12)13-8(2)9-6-4-5-7-11-9/h4-8H,3H2,1-2H3 |
| InChIKey | UHZGTKFRQGUYIJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-pyridin-2-ylethyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyridin-2-ylethyl propanoate?
The IUPAC name of 1-pyridin-2-ylethyl propanoate (CID 141268318) is 1-pyridin-2-ylethyl propanoate.
What is the SMILES notation for 1-pyridin-2-ylethyl propanoate?
The canonical SMILES for 1-pyridin-2-ylethyl propanoate is CCC(=O)OC(C)c1ccccn1.
What is the InChIKey of 1-pyridin-2-ylethyl propanoate?
The InChIKey is UHZGTKFRQGUYIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-3-10(12)13-8(2)9-6-4-5-7-11-9/h4-8H,3H2,1-2H3.
What are the key properties of 1-pyridin-2-ylethyl propanoate?
1-pyridin-2-ylethyl propanoate has a molecular weight of 179.22 g/mol, XLogP of 2.10, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyridin-2-ylethyl propanoate is sourced from PubChem (CID 141268318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).