About 1-pyridin-2-ylethyl N-(aminomethylidene)carbamate
1-pyridin-2-ylethyl N-(aminomethylidene)carbamate (PubChem CID 91804895) has the molecular formula C9H11N3O2
and a molecular weight of 193.21 g/mol. Its IUPAC name is 1-pyridin-2-ylethyl N-(aminomethylidene)carbamate.
Molecular Properties
| Compound Name | 1-pyridin-2-ylethyl N-(aminomethylidene)carbamate |
| PubChem CID | 91804895 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 1-pyridin-2-ylethyl N-(aminomethylidene)carbamate |
| SMILES | CC(OC(=O)N=CN)c1ccccn1 |
| InChI | InChI=1S/C9H11N3O2/c1-7(14-9(13)12-6-10)8-4-2-3-5-11-8/h2-7H,1H3,(H2,10,12,13) |
| InChIKey | HYOVXZCSACQOCE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-pyridin-2-ylethyl N-(aminomethylidene)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyridin-2-ylethyl N-(aminomethylidene)carbamate?
The IUPAC name of 1-pyridin-2-ylethyl N-(aminomethylidene)carbamate (CID 91804895) is 1-pyridin-2-ylethyl N-(aminomethylidene)carbamate.
What is the SMILES notation for 1-pyridin-2-ylethyl N-(aminomethylidene)carbamate?
The canonical SMILES for 1-pyridin-2-ylethyl N-(aminomethylidene)carbamate is CC(OC(=O)N=CN)c1ccccn1.
What is the InChIKey of 1-pyridin-2-ylethyl N-(aminomethylidene)carbamate?
The InChIKey is HYOVXZCSACQOCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2/c1-7(14-9(13)12-6-10)8-4-2-3-5-11-8/h2-7H,1H3,(H2,10,12,13).
What are the key properties of 1-pyridin-2-ylethyl N-(aminomethylidene)carbamate?
1-pyridin-2-ylethyl N-(aminomethylidene)carbamate has a molecular weight of 193.21 g/mol, XLogP of 1.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyridin-2-ylethyl N-(aminomethylidene)carbamate is sourced from PubChem (CID 91804895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).