C18H27F2NO3 — CID 71041464
tert-butyl 4-[amino-[4-(difluoromethoxy)phenyl]methyl]hexanoate (PubChem CID 71041464) has the molecular formula C18H27F2NO3 and a molecular weight of 343.41 g/mol. Its IUPAC name is tert-butyl 4-[amino-[4-(difluoromethoxy)phenyl]methyl]hexanoate.
| Compound Name | tert-butyl 4-[amino-[4-(difluoromethoxy)phenyl]methyl]hexanoate |
|---|---|
| PubChem CID | 71041464 |
| Molecular Formula | C18H27F2NO3 |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | tert-butyl 4-[amino-[4-(difluoromethoxy)phenyl]methyl]hexanoate |
| SMILES | CCC(CCC(=O)OC(C)(C)C)C(N)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H27F2NO3/c1-5-12(8-11-15(22)24-18(2,3)4)16(21)13-6-9-14(10-7-13)23-17(19)20/h6-7,9-10,12,16-17H,5,8,11,21H2,1-4H3 |
| InChIKey | AZJUAYKMKMVYDU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |