C14H23NO3 — CID 83928885
1-amino-4-(3,4-dimethoxyphenyl)hexan-2-ol (PubChem CID 83928885) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 1-amino-4-(3,4-dimethoxyphenyl)hexan-2-ol.
| Compound Name | 1-amino-4-(3,4-dimethoxyphenyl)hexan-2-ol |
|---|---|
| PubChem CID | 83928885 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 1-amino-4-(3,4-dimethoxyphenyl)hexan-2-ol |
| SMILES | CCC(CC(O)CN)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H23NO3/c1-4-10(7-12(16)9-15)11-5-6-13(17-2)14(8-11)18-3/h5-6,8,10,12,16H,4,7,9,15H2,1-3H3 |
| InChIKey | BEYQOTUVRCMEMJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |