C12H17Cl2NO — CID 83924872
1-amino-4-(3,5-dichlorophenyl)hexan-2-ol (PubChem CID 83924872) has the molecular formula C12H17Cl2NO and a molecular weight of 262.18 g/mol. Its IUPAC name is 1-amino-4-(3,5-dichlorophenyl)hexan-2-ol.
| Compound Name | 1-amino-4-(3,5-dichlorophenyl)hexan-2-ol |
|---|---|
| PubChem CID | 83924872 |
| Molecular Formula | C12H17Cl2NO |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 1-amino-4-(3,5-dichlorophenyl)hexan-2-ol |
| SMILES | CCC(CC(O)CN)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H17Cl2NO/c1-2-8(5-12(16)7-15)9-3-10(13)6-11(14)4-9/h3-4,6,8,12,16H,2,5,7,15H2,1H3 |
| InChIKey | ZJAVIPAXEYHSAM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |