C14H22FNO — CID 83931690
1-amino-4-(2-fluoro-4,5-dimethylphenyl)hexan-2-ol (PubChem CID 83931690) has the molecular formula C14H22FNO and a molecular weight of 239.33 g/mol. Its IUPAC name is 1-amino-4-(2-fluoro-4,5-dimethylphenyl)hexan-2-ol.
| Compound Name | 1-amino-4-(2-fluoro-4,5-dimethylphenyl)hexan-2-ol |
|---|---|
| PubChem CID | 83931690 |
| Molecular Formula | C14H22FNO |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 1-amino-4-(2-fluoro-4,5-dimethylphenyl)hexan-2-ol |
| SMILES | CCC(CC(O)CN)c1cc(C)c(C)cc1F |
| InChI | InChI=1S/C14H22FNO/c1-4-11(7-12(17)8-16)13-5-9(2)10(3)6-14(13)15/h5-6,11-12,17H,4,7-8,16H2,1-3H3 |
| InChIKey | IBJGDDJFNLVCOA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |