C16H24O4 — CID 83958717
3-(3-methoxy-4-propoxyphenyl)hexanoic acid (PubChem CID 83958717) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 3-(3-methoxy-4-propoxyphenyl)hexanoic acid.
| Compound Name | 3-(3-methoxy-4-propoxyphenyl)hexanoic acid |
|---|---|
| PubChem CID | 83958717 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 3-(3-methoxy-4-propoxyphenyl)hexanoic acid |
| SMILES | CCCOc1ccc(C(CCC)CC(=O)O)cc1OC |
| InChI | InChI=1S/C16H24O4/c1-4-6-12(11-16(17)18)13-7-8-14(20-9-5-2)15(10-13)19-3/h7-8,10,12H,4-6,9,11H2,1-3H3,(H,17,18) |
| InChIKey | BWKHCGZYHHNMCR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |