C21H34N2O4 — CID 3658845
N-[(3-methoxy-4-propoxyphenyl)-(3-methylbutanoylamino)methyl]-3-methylbutanamide (PubChem CID 3658845) has the molecular formula C21H34N2O4 and a molecular weight of 378.51 g/mol. Its IUPAC name is N-[(3-methoxy-4-propoxyphenyl)-(3-methylbutanoylamino)methyl]-3-methylbutanamide.
| Compound Name | N-[(3-methoxy-4-propoxyphenyl)-(3-methylbutanoylamino)methyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 3658845 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | N-[(3-methoxy-4-propoxyphenyl)-(3-methylbutanoylamino)methyl]-3-methylbutanamide |
| SMILES | CCCOc1ccc(C(NC(=O)CC(C)C)NC(=O)CC(C)C)cc1OC |
| InChI | InChI=1S/C21H34N2O4/c1-7-10-27-17-9-8-16(13-18(17)26-6)21(22-19(24)11-14(2)3)23-20(25)12-15(4)5/h8-9,13-15,21H,7,10-12H2,1-6H3,(H,22,24)(H,23,25) |
| InChIKey | VTMBXXASYDUPEZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|