C31H38N2O6 — CID 18890110
N-[[4-methoxy-3-(3-methylbutoxy)phenyl]-[[2-(4-methoxyphenyl)acetyl]amino]methyl]-2-(4-methoxyphenyl)acetamide (PubChem CID 18890110) has the molecular formula C31H38N2O6 and a molecular weight of 534.65 g/mol. Its IUPAC name is N-[[4-methoxy-3-(3-methylbutoxy)phenyl]-[[2-(4-methoxyphenyl)acetyl]amino]methyl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[[4-methoxy-3-(3-methylbutoxy)phenyl]-[[2-(4-methoxyphenyl)acetyl]amino]methyl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 18890110 |
| Molecular Formula | C31H38N2O6 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | N-[[4-methoxy-3-(3-methylbutoxy)phenyl]-[[2-(4-methoxyphenyl)acetyl]amino]methyl]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NC(NC(=O)Cc2ccc(OC)cc2)c2ccc(OC)c(OCCC(C)C)c2)cc1 |
| InChI | InChI=1S/C31H38N2O6/c1-21(2)16-17-39-28-20-24(10-15-27(28)38-5)31(32-29(34)18-22-6-11-25(36-3)12-7-22)33-30(35)19-23-8-13-26(37-4)14-9-23/h6-15,20-21,31H,16-19H2,1-5H3,(H,32,34)(H,33,35) |
| InChIKey | NUBUKNGVZTVYSR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|